C7H12N4O2 — CID 107410018
4-(2-aminocyclopentyl)-1,2,4-triazolidine-3,5-dione (PubChem CID 107410018) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is 4-(2-aminocyclopentyl)-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-(2-aminocyclopentyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 107410018 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 4-(2-aminocyclopentyl)-1,2,4-triazolidine-3,5-dione |
| SMILES | NC1CCCC1n1c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C7H12N4O2/c8-4-2-1-3-5(4)11-6(12)9-10-7(11)13/h4-5H,1-3,8H2,(H,9,12)(H,10,13) |
| InChIKey | BELYDIQEOSDJAG-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |