C23H18Cl2N2O2 — CID 10741034
3,5-dichloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide (PubChem CID 10741034) has the molecular formula C23H18Cl2N2O2 and a molecular weight of 425.32 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide.
| Compound Name | 3,5-dichloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 10741034 |
| Molecular Formula | C23H18Cl2N2O2 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 3,5-dichloro-N-[4-(3,4-dihydro-2H-quinoline-1-carbonyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCCc3ccccc32)cc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H18Cl2N2O2/c24-18-12-17(13-19(25)14-18)22(28)26-20-9-7-16(8-10-20)23(29)27-11-3-5-15-4-1-2-6-21(15)27/h1-2,4,6-10,12-14H,3,5,11H2,(H,26,28) |
| InChIKey | XRMQXOYLWNWWCU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |