About 4-(5-oxo-1H-1,2,4-triazol-4-yl)butanethioamide
4-(5-oxo-1H-1,2,4-triazol-4-yl)butanethioamide (PubChem CID 107410514) has the molecular formula C6H10N4OS
and a molecular weight of 186.24 g/mol. Its IUPAC name is 4-(5-oxo-1H-1,2,4-triazol-4-yl)butanethioamide.
Molecular Properties
| Compound Name | 4-(5-oxo-1H-1,2,4-triazol-4-yl)butanethioamide |
| PubChem CID | 107410514 |
| Molecular Formula | C6H10N4OS |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 4-(5-oxo-1H-1,2,4-triazol-4-yl)butanethioamide |
| SMILES | NC(=S)CCCn1cn[nH]c1=O |
| InChI | InChI=1S/C6H10N4OS/c7-5(12)2-1-3-10-4-8-9-6(10)11/h4H,1-3H2,(H2,7,12)(H,9,11) |
| InChIKey | TZMOJOZPJCVFNY-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-oxo-1H-1,2,4-triazol-4-yl)butanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-oxo-1H-1,2,4-triazol-4-yl)butanethioamide?
The IUPAC name of 4-(5-oxo-1H-1,2,4-triazol-4-yl)butanethioamide (CID 107410514) is 4-(5-oxo-1H-1,2,4-triazol-4-yl)butanethioamide.
What is the SMILES notation for 4-(5-oxo-1H-1,2,4-triazol-4-yl)butanethioamide?
The canonical SMILES for 4-(5-oxo-1H-1,2,4-triazol-4-yl)butanethioamide is NC(=S)CCCn1cn[nH]c1=O.
What is the InChIKey of 4-(5-oxo-1H-1,2,4-triazol-4-yl)butanethioamide?
The InChIKey is TZMOJOZPJCVFNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4OS/c7-5(12)2-1-3-10-4-8-9-6(10)11/h4H,1-3H2,(H2,7,12)(H,9,11).
What are the key properties of 4-(5-oxo-1H-1,2,4-triazol-4-yl)butanethioamide?
4-(5-oxo-1H-1,2,4-triazol-4-yl)butanethioamide has a molecular weight of 186.24 g/mol, XLogP of -0.36, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-oxo-1H-1,2,4-triazol-4-yl)butanethioamide is sourced from PubChem (CID 107410514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).