About 4-[1-(hydroxymethyl)cyclobutyl]-1H-1,2,4-triazol-5-one
4-[1-(hydroxymethyl)cyclobutyl]-1H-1,2,4-triazol-5-one (PubChem CID 107410821) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-[1-(hydroxymethyl)cyclobutyl]-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 4-[1-(hydroxymethyl)cyclobutyl]-1H-1,2,4-triazol-5-one |
| PubChem CID | 107410821 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 4-[1-(hydroxymethyl)cyclobutyl]-1H-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]ncn1C1(CO)CCC1 |
| InChI | InChI=1S/C7H11N3O2/c11-4-7(2-1-3-7)10-5-8-9-6(10)12/h5,11H,1-4H2,(H,9,12) |
| InChIKey | XVZJSHBIOIITKV-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1-(hydroxymethyl)cyclobutyl]-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(hydroxymethyl)cyclobutyl]-1H-1,2,4-triazol-5-one?
The IUPAC name of 4-[1-(hydroxymethyl)cyclobutyl]-1H-1,2,4-triazol-5-one (CID 107410821) is 4-[1-(hydroxymethyl)cyclobutyl]-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 4-[1-(hydroxymethyl)cyclobutyl]-1H-1,2,4-triazol-5-one?
The canonical SMILES for 4-[1-(hydroxymethyl)cyclobutyl]-1H-1,2,4-triazol-5-one is O=c1[nH]ncn1C1(CO)CCC1.
What is the InChIKey of 4-[1-(hydroxymethyl)cyclobutyl]-1H-1,2,4-triazol-5-one?
The InChIKey is XVZJSHBIOIITKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c11-4-7(2-1-3-7)10-5-8-9-6(10)12/h5,11H,1-4H2,(H,9,12).
What are the key properties of 4-[1-(hydroxymethyl)cyclobutyl]-1H-1,2,4-triazol-5-one?
4-[1-(hydroxymethyl)cyclobutyl]-1H-1,2,4-triazol-5-one has a molecular weight of 169.18 g/mol, XLogP of -0.56, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(hydroxymethyl)cyclobutyl]-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 107410821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).