C13H9F5N4O3S2 — CID 10741174
methyl (2S)-3-(2,3,4,5,6-pentafluorophenyl)-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamoylamino]propanoate (PubChem CID 10741174) has the molecular formula C13H9F5N4O3S2 and a molecular weight of 428.36 g/mol. Its IUPAC name is methyl (2S)-3-(2,3,4,5,6-pentafluorophenyl)-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamoylamino]propanoate.
| Compound Name | methyl (2S)-3-(2,3,4,5,6-pentafluorophenyl)-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamoylamino]propanoate |
|---|---|
| PubChem CID | 10741174 |
| Molecular Formula | C13H9F5N4O3S2 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | methyl (2S)-3-(2,3,4,5,6-pentafluorophenyl)-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)carbamoylamino]propanoate |
| SMILES | COC(=O)[C@H](Cc1c(F)c(F)c(F)c(F)c1F)NC(=O)Nc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C13H9F5N4O3S2/c1-25-10(23)4(19-11(24)20-12-21-22-13(26)27-12)2-3-5(14)7(16)9(18)8(17)6(3)15/h4H,2H2,1H3,(H,22,26)(H2,19,20,21,24)/t4-/m0/s1 |
| InChIKey | VRUQBYFWLGFKCL-BYPYZUCNSA-N |
| XLogP | 2.80 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|