About 4-[1-(4-methoxyphenyl)-4,6-diphenyl-2-pyridinylidene]cyclohexa-2,5-dien-1-one
4-[1-(4-methoxyphenyl)-4,6-diphenyl-2-pyridinylidene]cyclohexa-2,5-dien-1-one (PubChem CID 10741243) has the molecular formula C30H23NO2
and a molecular weight of 429.52 g/mol. Its IUPAC name is 4-[1-(4-methoxyphenyl)-4,6-diphenyl-2-pyridinylidene]cyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 4-[1-(4-methoxyphenyl)-4,6-diphenyl-2-pyridinylidene]cyclohexa-2,5-dien-1-one |
| PubChem CID | 10741243 |
| Molecular Formula | C30H23NO2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 4-[1-(4-methoxyphenyl)-4,6-diphenyl-2-pyridinylidene]cyclohexa-2,5-dien-1-one |
| SMILES | COc1ccc(N2C(c3ccccc3)=CC(c3ccccc3)=CC2=C2C=CC(=O)C=C2)cc1 |
| InChI | InChI=1S/C30H23NO2/c1-33-28-18-14-26(15-19-28)31-29(23-10-6-3-7-11-23)20-25(22-8-4-2-5-9-22)21-30(31)24-12-16-27(32)17-13-24/h2-21H,1H3 |
| InChIKey | ORQNDSDEEZUCHJ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[1-(4-methoxyphenyl)-4,6-diphenyl-2-pyridinylidene]cyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-methoxyphenyl)-4,6-diphenyl-2-pyridinylidene]cyclohexa-2,5-dien-1-one?
The IUPAC name of 4-[1-(4-methoxyphenyl)-4,6-diphenyl-2-pyridinylidene]cyclohexa-2,5-dien-1-one (CID 10741243) is 4-[1-(4-methoxyphenyl)-4,6-diphenyl-2-pyridinylidene]cyclohexa-2,5-dien-1-one.
What is the SMILES notation for 4-[1-(4-methoxyphenyl)-4,6-diphenyl-2-pyridinylidene]cyclohexa-2,5-dien-1-one?
The canonical SMILES for 4-[1-(4-methoxyphenyl)-4,6-diphenyl-2-pyridinylidene]cyclohexa-2,5-dien-1-one is COc1ccc(N2C(c3ccccc3)=CC(c3ccccc3)=CC2=C2C=CC(=O)C=C2)cc1.
What is the InChIKey of 4-[1-(4-methoxyphenyl)-4,6-diphenyl-2-pyridinylidene]cyclohexa-2,5-dien-1-one?
The InChIKey is ORQNDSDEEZUCHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H23NO2/c1-33-28-18-14-26(15-19-28)31-29(23-10-6-3-7-11-23)20-25(22-8-4-2-5-9-22)21-30(31)24-12-16-27(32)17-13-24/h2-21H,1H3.
What are the key properties of 4-[1-(4-methoxyphenyl)-4,6-diphenyl-2-pyridinylidene]cyclohexa-2,5-dien-1-one?
4-[1-(4-methoxyphenyl)-4,6-diphenyl-2-pyridinylidene]cyclohexa-2,5-dien-1-one has a molecular weight of 429.52 g/mol, XLogP of 6.59, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-methoxyphenyl)-4,6-diphenyl-2-pyridinylidene]cyclohexa-2,5-dien-1-one is sourced from PubChem (CID 10741243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).