C15H19FN2O3 — CID 107412478
2-fluoro-3-methyl-N-[(3-methylcyclopentyl)methyl]-5-nitrobenzamide (PubChem CID 107412478) has the molecular formula C15H19FN2O3 and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-fluoro-3-methyl-N-[(3-methylcyclopentyl)methyl]-5-nitrobenzamide.
| Compound Name | 2-fluoro-3-methyl-N-[(3-methylcyclopentyl)methyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 107412478 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-fluoro-3-methyl-N-[(3-methylcyclopentyl)methyl]-5-nitrobenzamide |
| SMILES | Cc1cc([N+](=O)[O-])cc(C(=O)NCC2CCC(C)C2)c1F |
| InChI | InChI=1S/C15H19FN2O3/c1-9-3-4-11(5-9)8-17-15(19)13-7-12(18(20)21)6-10(2)14(13)16/h6-7,9,11H,3-5,8H2,1-2H3,(H,17,19) |
| InChIKey | NMBSLYSLRITCPI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|