C25H39NO3Si — CID 10741256
benzyl (2S,3R)-6-ethenyl-2-methyl-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 10741256) has the molecular formula C25H39NO3Si and a molecular weight of 429.68 g/mol. Its IUPAC name is benzyl (2S,3R)-6-ethenyl-2-methyl-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | benzyl (2S,3R)-6-ethenyl-2-methyl-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 10741256 |
| Molecular Formula | C25H39NO3Si |
| Molecular Weight | 429.68 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | benzyl (2S,3R)-6-ethenyl-2-methyl-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=CC1=CC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H39NO3Si/c1-9-23-15-16-24(29-30(18(2)3,19(4)5)20(6)7)21(8)26(23)25(27)28-17-22-13-11-10-12-14-22/h9-15,18-21,24H,1,16-17H2,2-8H3/t21-,24+/m0/s1 |
| InChIKey | VSXBEITZKNVZQF-XUZZJYLKSA-N |
| XLogP | 7.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.68 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|