C27H30O3Si — CID 10741300
1-[tert-butyl(diphenyl)silyl]-2-[hydroxy-(4-methoxyphenyl)methyl]prop-2-en-1-one (PubChem CID 10741300) has the molecular formula C27H30O3Si and a molecular weight of 430.62 g/mol. Its IUPAC name is 1-[tert-butyl(diphenyl)silyl]-2-[hydroxy-(4-methoxyphenyl)methyl]prop-2-en-1-one.
| Compound Name | 1-[tert-butyl(diphenyl)silyl]-2-[hydroxy-(4-methoxyphenyl)methyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 10741300 |
| Molecular Formula | C27H30O3Si |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-[tert-butyl(diphenyl)silyl]-2-[hydroxy-(4-methoxyphenyl)methyl]prop-2-en-1-one |
| SMILES | C=C(C(=O)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H30O3Si/c1-20(25(28)21-16-18-22(30-5)19-17-21)26(29)31(27(2,3)4,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-19,25,28H,1H2,2-5H3 |
| InChIKey | CSWIBPWRJIXOFW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|