C11H16IN3 — CID 107414024
5-iodo-N-[(3-methylcyclopentyl)methyl]pyrimidin-4-amine (PubChem CID 107414024) has the molecular formula C11H16IN3 and a molecular weight of 317.17 g/mol. Its IUPAC name is 5-iodo-N-[(3-methylcyclopentyl)methyl]pyrimidin-4-amine.
| Compound Name | 5-iodo-N-[(3-methylcyclopentyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 107414024 |
| Molecular Formula | C11H16IN3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 5-iodo-N-[(3-methylcyclopentyl)methyl]pyrimidin-4-amine |
| SMILES | CC1CCC(CNc2ncncc2I)C1 |
| InChI | InChI=1S/C11H16IN3/c1-8-2-3-9(4-8)5-14-11-10(12)6-13-7-15-11/h6-9H,2-5H2,1H3,(H,13,14,15) |
| InChIKey | GIWMFJQXUAEYCP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|