C17H22ClFN2 — CID 107414438
2-(1-chloroethyl)-5-fluoro-6-methyl-1-[(3-methylcyclopentyl)methyl]benzimidazole (PubChem CID 107414438) has the molecular formula C17H22ClFN2 and a molecular weight of 308.83 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-fluoro-6-methyl-1-[(3-methylcyclopentyl)methyl]benzimidazole.
| Compound Name | 2-(1-chloroethyl)-5-fluoro-6-methyl-1-[(3-methylcyclopentyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 107414438 |
| Molecular Formula | C17H22ClFN2 |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-(1-chloroethyl)-5-fluoro-6-methyl-1-[(3-methylcyclopentyl)methyl]benzimidazole |
| SMILES | Cc1cc2c(cc1F)nc(C(C)Cl)n2CC1CCC(C)C1 |
| InChI | InChI=1S/C17H22ClFN2/c1-10-4-5-13(6-10)9-21-16-7-11(2)14(19)8-15(16)20-17(21)12(3)18/h7-8,10,12-13H,4-6,9H2,1-3H3 |
| InChIKey | DWLZQVNHIZBCQB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|