C16H25N3O — CID 107415057
1-[4-(1-aminoethyl)phenyl]-3-[(3-methylcyclopentyl)methyl]urea (PubChem CID 107415057) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 1-[4-(1-aminoethyl)phenyl]-3-[(3-methylcyclopentyl)methyl]urea.
| Compound Name | 1-[4-(1-aminoethyl)phenyl]-3-[(3-methylcyclopentyl)methyl]urea |
|---|---|
| PubChem CID | 107415057 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 1-[4-(1-aminoethyl)phenyl]-3-[(3-methylcyclopentyl)methyl]urea |
| SMILES | CC1CCC(CNC(=O)Nc2ccc(C(C)N)cc2)C1 |
| InChI | InChI=1S/C16H25N3O/c1-11-3-4-13(9-11)10-18-16(20)19-15-7-5-14(6-8-15)12(2)17/h5-8,11-13H,3-4,9-10,17H2,1-2H3,(H2,18,19,20) |
| InChIKey | BDWXZPKBHKVNKS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |