C14H18BrN5 — CID 107415099
2-bromo-5-[1-[(3-methylcyclopentyl)methyl]tetrazol-5-yl]aniline (PubChem CID 107415099) has the molecular formula C14H18BrN5 and a molecular weight of 336.24 g/mol. Its IUPAC name is 2-bromo-5-[1-[(3-methylcyclopentyl)methyl]tetrazol-5-yl]aniline.
| Compound Name | 2-bromo-5-[1-[(3-methylcyclopentyl)methyl]tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 107415099 |
| Molecular Formula | C14H18BrN5 |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-bromo-5-[1-[(3-methylcyclopentyl)methyl]tetrazol-5-yl]aniline |
| SMILES | CC1CCC(Cn2nnnc2-c2ccc(Br)c(N)c2)C1 |
| InChI | InChI=1S/C14H18BrN5/c1-9-2-3-10(6-9)8-20-14(17-18-19-20)11-4-5-12(15)13(16)7-11/h4-5,7,9-10H,2-3,6,8,16H2,1H3 |
| InChIKey | BNLVEPRAJCJJRK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|