C25H42O6 — CID 10741676
(6R,7E,10R,14S)-14-(6,8-dihydroxy-2-methylidenenonyl)-6,10-dihydroxy-8-methyl-12-methylidene-1-oxacyclotetradec-7-en-2-one (PubChem CID 10741676) has the molecular formula C25H42O6 and a molecular weight of 438.61 g/mol. Its IUPAC name is (6R,7E,10R,14S)-14-(6,8-dihydroxy-2-methylidenenonyl)-6,10-dihydroxy-8-methyl-12-methylidene-1-oxacyclotetradec-7-en-2-one.
| Compound Name | (6R,7E,10R,14S)-14-(6,8-dihydroxy-2-methylidenenonyl)-6,10-dihydroxy-8-methyl-12-methylidene-1-oxacyclotetradec-7-en-2-one |
|---|---|
| PubChem CID | 10741676 |
| Molecular Formula | C25H42O6 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (6R,7E,10R,14S)-14-(6,8-dihydroxy-2-methylidenenonyl)-6,10-dihydroxy-8-methyl-12-methylidene-1-oxacyclotetradec-7-en-2-one |
| SMILES | C=C(CCCC(O)CC(C)O)C[C@H]1CC(=C)C[C@@H](O)C/C(C)=C/[C@H](O)CCCC(=O)O1 |
| InChI | InChI=1S/C25H42O6/c1-17(7-5-8-22(28)16-20(4)26)14-24-15-19(3)13-23(29)12-18(2)11-21(27)9-6-10-25(30)31-24/h11,20-24,26-29H,1,3,5-10,12-16H2,2,4H3/b18-11+/t20?,21-,22?,23+,24+/m1/s1 |
| InChIKey | ZDRUEHAANPCQTG-NARSDYRHSA-N |
| XLogP | 3.73 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|