C22H22ClF3N2O2 — CID 10741689
N-[2-[(3-chloro-1H-indol-4-yl)oxy]ethyl]-2,2,2-trifluoro-N-(4-phenylbutyl)acetamide (PubChem CID 10741689) has the molecular formula C22H22ClF3N2O2 and a molecular weight of 438.88 g/mol. Its IUPAC name is N-[2-[(3-chloro-1H-indol-4-yl)oxy]ethyl]-2,2,2-trifluoro-N-(4-phenylbutyl)acetamide.
| Compound Name | N-[2-[(3-chloro-1H-indol-4-yl)oxy]ethyl]-2,2,2-trifluoro-N-(4-phenylbutyl)acetamide |
|---|---|
| PubChem CID | 10741689 |
| Molecular Formula | C22H22ClF3N2O2 |
| Molecular Weight | 438.88 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-[2-[(3-chloro-1H-indol-4-yl)oxy]ethyl]-2,2,2-trifluoro-N-(4-phenylbutyl)acetamide |
| SMILES | O=C(N(CCCCc1ccccc1)CCOc1cccc2[nH]cc(Cl)c12)C(F)(F)F |
| InChI | InChI=1S/C22H22ClF3N2O2/c23-17-15-27-18-10-6-11-19(20(17)18)30-14-13-28(21(29)22(24,25)26)12-5-4-9-16-7-2-1-3-8-16/h1-3,6-8,10-11,15,27H,4-5,9,12-14H2 |
| InChIKey | OYWHPOMTZXJLDX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.88 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|