C12H22ClNO — CID 107417691
3-chloro-2,2-dimethyl-N-[(2-methylcyclopentyl)methyl]propanamide (PubChem CID 107417691) has the molecular formula C12H22ClNO and a molecular weight of 231.77 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[(2-methylcyclopentyl)methyl]propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-[(2-methylcyclopentyl)methyl]propanamide |
|---|---|
| PubChem CID | 107417691 |
| Molecular Formula | C12H22ClNO |
| Molecular Weight | 231.77 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[(2-methylcyclopentyl)methyl]propanamide |
| SMILES | CC1CCCC1CNC(=O)C(C)(C)CCl |
| InChI | InChI=1S/C12H22ClNO/c1-9-5-4-6-10(9)7-14-11(15)12(2,3)8-13/h9-10H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | AYCIHSLDXNLFCE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.77 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|