C16H23NO2 — CID 107418280
2-[2-[[(2-methylcyclopentyl)methylamino]methyl]phenyl]acetic acid (PubChem CID 107418280) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-[2-[[(2-methylcyclopentyl)methylamino]methyl]phenyl]acetic acid.
| Compound Name | 2-[2-[[(2-methylcyclopentyl)methylamino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 107418280 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-[2-[[(2-methylcyclopentyl)methylamino]methyl]phenyl]acetic acid |
| SMILES | CC1CCCC1CNCc1ccccc1CC(=O)O |
| InChI | InChI=1S/C16H23NO2/c1-12-5-4-8-14(12)10-17-11-15-7-3-2-6-13(15)9-16(18)19/h2-3,6-7,12,14,17H,4-5,8-11H2,1H3,(H,18,19) |
| InChIKey | JWVNAEZFAUCOII-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |