C30H28O2Si — CID 10742121
(4S,7S)-4,7-dibenzyl-2,2-diphenyl-4,7-dihydro-1,3,2-dioxasilepine (PubChem CID 10742121) has the molecular formula C30H28O2Si and a molecular weight of 448.64 g/mol. Its IUPAC name is (4S,7S)-4,7-dibenzyl-2,2-diphenyl-4,7-dihydro-1,3,2-dioxasilepine.
| Compound Name | (4S,7S)-4,7-dibenzyl-2,2-diphenyl-4,7-dihydro-1,3,2-dioxasilepine |
|---|---|
| PubChem CID | 10742121 |
| Molecular Formula | C30H28O2Si |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | (4S,7S)-4,7-dibenzyl-2,2-diphenyl-4,7-dihydro-1,3,2-dioxasilepine |
| SMILES | C1=C[C@H](Cc2ccccc2)O[Si](c2ccccc2)(c2ccccc2)O[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C30H28O2Si/c1-5-13-25(14-6-1)23-27-21-22-28(24-26-15-7-2-8-16-26)32-33(31-27,29-17-9-3-10-18-29)30-19-11-4-12-20-30/h1-22,27-28H,23-24H2/t27-,28-/m1/s1 |
| InChIKey | VNKCFTJYFYDUDK-VSGBNLITSA-N |
| XLogP | 5.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|