C9H12N4OS — CID 107421679
[3-methyl-2-(pyrazol-1-ylmethylsulfanyl)imidazol-4-yl]methanol (PubChem CID 107421679) has the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. Its IUPAC name is [3-methyl-2-(pyrazol-1-ylmethylsulfanyl)imidazol-4-yl]methanol.
| Compound Name | [3-methyl-2-(pyrazol-1-ylmethylsulfanyl)imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 107421679 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | [3-methyl-2-(pyrazol-1-ylmethylsulfanyl)imidazol-4-yl]methanol |
| SMILES | Cn1c(CO)cnc1SCn1cccn1 |
| InChI | InChI=1S/C9H12N4OS/c1-12-8(6-14)5-10-9(12)15-7-13-4-2-3-11-13/h2-5,14H,6-7H2,1H3 |
| InChIKey | MWRLTLYHYJSFFS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |