C15H15BrN2O2S — CID 107421746
N-(4-bromo-3-methylphenyl)-2,3-dihydro-1H-isoindole-5-sulfonamide (PubChem CID 107421746) has the molecular formula C15H15BrN2O2S and a molecular weight of 367.27 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2,3-dihydro-1H-isoindole-5-sulfonamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2,3-dihydro-1H-isoindole-5-sulfonamide |
|---|---|
| PubChem CID | 107421746 |
| Molecular Formula | C15H15BrN2O2S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2,3-dihydro-1H-isoindole-5-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc3c(c2)CNC3)ccc1Br |
| InChI | InChI=1S/C15H15BrN2O2S/c1-10-6-13(3-5-15(10)16)18-21(19,20)14-4-2-11-8-17-9-12(11)7-14/h2-7,17-18H,8-9H2,1H3 |
| InChIKey | BILPTZUYJLPMKM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |