C15H17N3O2S — CID 107422496
N-ethyl-N-pyridin-4-yl-2,3-dihydro-1H-isoindole-5-sulfonamide (PubChem CID 107422496) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is N-ethyl-N-pyridin-4-yl-2,3-dihydro-1H-isoindole-5-sulfonamide.
| Compound Name | N-ethyl-N-pyridin-4-yl-2,3-dihydro-1H-isoindole-5-sulfonamide |
|---|---|
| PubChem CID | 107422496 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-ethyl-N-pyridin-4-yl-2,3-dihydro-1H-isoindole-5-sulfonamide |
| SMILES | CCN(c1ccncc1)S(=O)(=O)c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C15H17N3O2S/c1-2-18(14-5-7-16-8-6-14)21(19,20)15-4-3-12-10-17-11-13(12)9-15/h3-9,17H,2,10-11H2,1H3 |
| InChIKey | PCEXREWXXYRILC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |