C23H40O5Si2 — CID 10742301
ethyl (1R,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3-methyl-6-(2-trimethylsilylfuran-3-yl)cyclohex-2-ene-1-carboxylate (PubChem CID 10742301) has the molecular formula C23H40O5Si2 and a molecular weight of 452.74 g/mol. Its IUPAC name is ethyl (1R,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3-methyl-6-(2-trimethylsilylfuran-3-yl)cyclohex-2-ene-1-carboxylate.
| Compound Name | ethyl (1R,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3-methyl-6-(2-trimethylsilylfuran-3-yl)cyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 10742301 |
| Molecular Formula | C23H40O5Si2 |
| Molecular Weight | 452.74 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | ethyl (1R,4S,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3-methyl-6-(2-trimethylsilylfuran-3-yl)cyclohex-2-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]1(O)c1ccoc1[Si](C)(C)C |
| InChI | InChI=1S/C23H40O5Si2/c1-11-26-20(24)18-14-16(2)19(28-30(9,10)22(3,4)5)15-23(18,25)17-12-13-27-21(17)29(6,7)8/h12-14,18-19,25H,11,15H2,1-10H3/t18-,19-,23+/m0/s1 |
| InChIKey | LRYPXYTZMOWVOS-SFYKDHMMSA-N |
| XLogP | 4.93 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.74 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|