C10H7F9N2O4S2 — CID 10742338
4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)benzenesulfonamide (PubChem CID 10742338) has the molecular formula C10H7F9N2O4S2 and a molecular weight of 454.29 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)benzenesulfonamide.
| Compound Name | 4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 10742338 |
| Molecular Formula | C10H7F9N2O4S2 |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 453.97 |
| IUPAC Name | 4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H7F9N2O4S2/c11-7(12,9(15,16)17)8(13,14)10(18,19)27(24,25)21-5-1-3-6(4-2-5)26(20,22)23/h1-4,21H,(H2,20,22,23) |
| InChIKey | OSOCFNMAGVWVCX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|