C13H17Cl2N3O — CID 107423637
N-(2,5-dichlorophenyl)-2-[(3-methylpyrrolidin-3-yl)amino]acetamide (PubChem CID 107423637) has the molecular formula C13H17Cl2N3O and a molecular weight of 302.20 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[(3-methylpyrrolidin-3-yl)amino]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[(3-methylpyrrolidin-3-yl)amino]acetamide |
|---|---|
| PubChem CID | 107423637 |
| Molecular Formula | C13H17Cl2N3O |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[(3-methylpyrrolidin-3-yl)amino]acetamide |
| SMILES | CC1(NCC(=O)Nc2cc(Cl)ccc2Cl)CCNC1 |
| InChI | InChI=1S/C13H17Cl2N3O/c1-13(4-5-16-8-13)17-7-12(19)18-11-6-9(14)2-3-10(11)15/h2-3,6,16-17H,4-5,7-8H2,1H3,(H,18,19) |
| InChIKey | HRQXHSBHQVSJOR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |