C11H24N2O2 — CID 107424198
N-(2,2-diethoxyethyl)-3-methylpyrrolidin-3-amine (PubChem CID 107424198) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-3-methylpyrrolidin-3-amine.
| Compound Name | N-(2,2-diethoxyethyl)-3-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 107424198 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | N-(2,2-diethoxyethyl)-3-methylpyrrolidin-3-amine |
| SMILES | CCOC(CNC1(C)CCNC1)OCC |
| InChI | InChI=1S/C11H24N2O2/c1-4-14-10(15-5-2)8-13-11(3)6-7-12-9-11/h10,12-13H,4-9H2,1-3H3 |
| InChIKey | WKCPTMQYEXZSSE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|