C14H19N5 — CID 107424502
2-[[(3-methylpyrrolidin-3-yl)amino]methyl]quinazolin-4-amine (PubChem CID 107424502) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-[[(3-methylpyrrolidin-3-yl)amino]methyl]quinazolin-4-amine.
| Compound Name | 2-[[(3-methylpyrrolidin-3-yl)amino]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 107424502 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-[[(3-methylpyrrolidin-3-yl)amino]methyl]quinazolin-4-amine |
| SMILES | CC1(NCc2nc(N)c3ccccc3n2)CCNC1 |
| InChI | InChI=1S/C14H19N5/c1-14(6-7-16-9-14)17-8-12-18-11-5-3-2-4-10(11)13(15)19-12/h2-5,16-17H,6-9H2,1H3,(H2,15,18,19) |
| InChIKey | UPPODVAYVCDZIA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |