C12H16F2N2 — CID 107424600
N-[(3,5-difluorophenyl)methyl]-3-methylpyrrolidin-3-amine (PubChem CID 107424600) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is N-[(3,5-difluorophenyl)methyl]-3-methylpyrrolidin-3-amine.
| Compound Name | N-[(3,5-difluorophenyl)methyl]-3-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 107424600 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N-[(3,5-difluorophenyl)methyl]-3-methylpyrrolidin-3-amine |
| SMILES | CC1(NCc2cc(F)cc(F)c2)CCNC1 |
| InChI | InChI=1S/C12H16F2N2/c1-12(2-3-15-8-12)16-7-9-4-10(13)6-11(14)5-9/h4-6,15-16H,2-3,7-8H2,1H3 |
| InChIKey | GEORPBJLKAZRGQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |