C26H40N2OSSi — CID 10742475
tert-butyl-[3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-thiophen-3-ylmethyl]phenoxy]-dimethylsilane (PubChem CID 10742475) has the molecular formula C26H40N2OSSi and a molecular weight of 456.77 g/mol. Its IUPAC name is tert-butyl-[3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-thiophen-3-ylmethyl]phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-thiophen-3-ylmethyl]phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10742475 |
| Molecular Formula | C26H40N2OSSi |
| Molecular Weight | 456.77 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | tert-butyl-[3-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-thiophen-3-ylmethyl]phenoxy]-dimethylsilane |
| SMILES | C=CCN1C[C@H](C)N([C@@H](c2ccsc2)c2cccc(O[Si](C)(C)C(C)(C)C)c2)C[C@H]1C |
| InChI | InChI=1S/C26H40N2OSSi/c1-9-14-27-17-21(3)28(18-20(27)2)25(23-13-15-30-19-23)22-11-10-12-24(16-22)29-31(7,8)26(4,5)6/h9-13,15-16,19-21,25H,1,14,17-18H2,2-8H3/t20-,21+,25-/m1/s1 |
| InChIKey | WXWRDVWVOIHFTR-TYBLODHISA-N |
| XLogP | 6.80 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.77 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|