C28H19N5O2 — CID 10742498
11,13-dioxo-N,N'-diphenylquinazolino[2,3-b]quinazoline-5-carboximidamide (PubChem CID 10742498) has the molecular formula C28H19N5O2 and a molecular weight of 457.49 g/mol. Its IUPAC name is 11,13-dioxo-N,N'-diphenylquinazolino[2,3-b]quinazoline-5-carboximidamide.
| Compound Name | 11,13-dioxo-N,N'-diphenylquinazolino[2,3-b]quinazoline-5-carboximidamide |
|---|---|
| PubChem CID | 10742498 |
| Molecular Formula | C28H19N5O2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 11,13-dioxo-N,N'-diphenylquinazolino[2,3-b]quinazoline-5-carboximidamide |
| SMILES | O=c1c2ccccc2nc2n(/C(=N/c3ccccc3)Nc3ccccc3)c3ccccc3c(=O)n12 |
| InChI | InChI=1S/C28H19N5O2/c34-25-21-15-7-9-17-23(21)31-28-32(24-18-10-8-16-22(24)26(35)33(25)28)27(29-19-11-3-1-4-12-19)30-20-13-5-2-6-14-20/h1-18H,(H,29,30) |
| InChIKey | HCRNNOVDZBNISV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|