About 1-ethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate)
1-ethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) (PubChem CID 10742526) has the molecular formula C10H17F7N2O6S2
and a molecular weight of 458.37 g/mol. Its IUPAC name is 1-ethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate).
Molecular Properties
| Compound Name | 1-ethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) |
| PubChem CID | 10742526 |
| Molecular Formula | C10H17F7N2O6S2 |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | 1-ethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) |
| SMILES | CC[N+]12CC[N+](F)(CC1)CC2.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C8H17FN2.2CHF3O3S/c1-2-10-3-6-11(9,7-4-10)8-5-10;2*2-1(3,4)8(5,6)7/h2-8H2,1H3;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | XRHAWRZPRKPZQY-UHFFFAOYSA-L |
| XLogP | 0.65 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate)?
The IUPAC name of 1-ethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) (CID 10742526) is 1-ethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate).
What is the SMILES notation for 1-ethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate)?
The canonical SMILES for 1-ethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) is CC[N+]12CC[N+](F)(CC1)CC2.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 1-ethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate)?
The InChIKey is XRHAWRZPRKPZQY-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H17FN2.2CHF3O3S/c1-2-10-3-6-11(9,7-4-10)8-5-10;2*2-1(3,4)8(5,6)7/h2-8H2,1H3;2*(H,5,6,7)/q+2;;/p-2.
What are the key properties of 1-ethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate)?
1-ethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) has a molecular weight of 458.37 g/mol, XLogP of 0.65, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) is sourced from PubChem (CID 10742526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).