About [6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate
[6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate (PubChem CID 10742532) has the molecular formula C23H22O10
and a molecular weight of 458.42 g/mol. Its IUPAC name is [6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate.
Molecular Properties
| Compound Name | [6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate |
| PubChem CID | 10742532 |
| Molecular Formula | C23H22O10 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | [6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate |
| SMILES | COc1ccc(-c2oc3c(OC)c(OC)c(OC(C)=O)c(OC(C)=O)c3c(=O)c2OC)cc1 |
| InChI | InChI=1S/C23H22O10/c1-11(24)31-19-15-16(26)20(28-4)17(13-7-9-14(27-3)10-8-13)33-18(15)21(29-5)22(30-6)23(19)32-12(2)25/h7-10H,1-6H3 |
| InChIKey | QDJJQGUTWZWNIQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 119.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate?
The IUPAC name of [6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate (CID 10742532) is [6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate.
What is the SMILES notation for [6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate?
The canonical SMILES for [6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate is COc1ccc(-c2oc3c(OC)c(OC)c(OC(C)=O)c(OC(C)=O)c3c(=O)c2OC)cc1.
What is the InChIKey of [6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate?
The InChIKey is QDJJQGUTWZWNIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O10/c1-11(24)31-19-15-16(26)20(28-4)17(13-7-9-14(27-3)10-8-13)33-18(15)21(29-5)22(30-6)23(19)32-12(2)25/h7-10H,1-6H3.
What are the key properties of [6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate?
[6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate has a molecular weight of 458.42 g/mol, XLogP of 3.35, 7 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate is sourced from PubChem (CID 10742532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).