C23H22O10 — CID 10742532
[6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate (PubChem CID 10742532) has the molecular formula C23H22O10 and a molecular weight of 458.42 g/mol. Its IUPAC name is [6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate.
| Compound Name | [6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate |
|---|---|
| PubChem CID | 10742532 |
| Molecular Formula | C23H22O10 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | [6-acetyloxy-3,7,8-trimethoxy-2-(4-methoxyphenyl)-4-oxochromen-5-yl] acetate |
| SMILES | COc1ccc(-c2oc3c(OC)c(OC)c(OC(C)=O)c(OC(C)=O)c3c(=O)c2OC)cc1 |
| InChI | InChI=1S/C23H22O10/c1-11(24)31-19-15-16(26)20(28-4)17(13-7-9-14(27-3)10-8-13)33-18(15)21(29-5)22(30-6)23(19)32-12(2)25/h7-10H,1-6H3 |
| InChIKey | QDJJQGUTWZWNIQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 119.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|