C16H26O7S4 — CID 10742550
6,6-bis(2-methoxyethoxymethoxymethyl)-5,7-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiepin-2-one (PubChem CID 10742550) has the molecular formula C16H26O7S4 and a molecular weight of 458.65 g/mol. Its IUPAC name is 6,6-bis(2-methoxyethoxymethoxymethyl)-5,7-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiepin-2-one.
| Compound Name | 6,6-bis(2-methoxyethoxymethoxymethyl)-5,7-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiepin-2-one |
|---|---|
| PubChem CID | 10742550 |
| Molecular Formula | C16H26O7S4 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 6,6-bis(2-methoxyethoxymethoxymethyl)-5,7-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiepin-2-one |
| SMILES | COCCOCOCC1(COCOCCOC)CSc2sc(=O)sc2SC1 |
| InChI | InChI=1S/C16H26O7S4/c1-18-3-5-20-11-22-7-16(8-23-12-21-6-4-19-2)9-24-13-14(25-10-16)27-15(17)26-13/h3-12H2,1-2H3 |
| InChIKey | KVXRTPJACQPMKT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|