C9H13IN4 — CID 107426009
5-iodo-N-(3-methylpyrrolidin-3-yl)pyrimidin-2-amine (PubChem CID 107426009) has the molecular formula C9H13IN4 and a molecular weight of 304.14 g/mol. Its IUPAC name is 5-iodo-N-(3-methylpyrrolidin-3-yl)pyrimidin-2-amine.
| Compound Name | 5-iodo-N-(3-methylpyrrolidin-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 107426009 |
| Molecular Formula | C9H13IN4 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 5-iodo-N-(3-methylpyrrolidin-3-yl)pyrimidin-2-amine |
| SMILES | CC1(Nc2ncc(I)cn2)CCNC1 |
| InChI | InChI=1S/C9H13IN4/c1-9(2-3-11-6-9)14-8-12-4-7(10)5-13-8/h4-5,11H,2-3,6H2,1H3,(H,12,13,14) |
| InChIKey | VRMKPWHKOYJMKF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|