C14H18FN3O2 — CID 107426085
2-[(3-cyano-2-fluorophenyl)methyl-[2-(dimethylamino)ethyl]amino]acetic acid (PubChem CID 107426085) has the molecular formula C14H18FN3O2 and a molecular weight of 279.31 g/mol. Its IUPAC name is 2-[(3-cyano-2-fluorophenyl)methyl-[2-(dimethylamino)ethyl]amino]acetic acid.
| Compound Name | 2-[(3-cyano-2-fluorophenyl)methyl-[2-(dimethylamino)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 107426085 |
| Molecular Formula | C14H18FN3O2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-[(3-cyano-2-fluorophenyl)methyl-[2-(dimethylamino)ethyl]amino]acetic acid |
| SMILES | CN(C)CCN(CC(=O)O)Cc1cccc(C#N)c1F |
| InChI | InChI=1S/C14H18FN3O2/c1-17(2)6-7-18(10-13(19)20)9-12-5-3-4-11(8-16)14(12)15/h3-5H,6-7,9-10H2,1-2H3,(H,19,20) |
| InChIKey | DWWQKADGRBKCAF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |