C18H37N9 — CID 10742618
2-[6-[[4-(butylamino)-6-(diethylamino)-1,3,5-triazin-2-yl]amino]hexyl]guanidine (PubChem CID 10742618) has the molecular formula C18H37N9 and a molecular weight of 379.56 g/mol. Its IUPAC name is 2-[6-[[4-(butylamino)-6-(diethylamino)-1,3,5-triazin-2-yl]amino]hexyl]guanidine.
| Compound Name | 2-[6-[[4-(butylamino)-6-(diethylamino)-1,3,5-triazin-2-yl]amino]hexyl]guanidine |
|---|---|
| PubChem CID | 10742618 |
| Molecular Formula | C18H37N9 |
| Molecular Weight | 379.56 g/mol |
| Exact Mass | 379.32 |
| IUPAC Name | 2-[6-[[4-(butylamino)-6-(diethylamino)-1,3,5-triazin-2-yl]amino]hexyl]guanidine |
| SMILES | CCCCNc1nc(NCCCCCCN=C(N)N)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C18H37N9/c1-4-7-12-22-16-24-17(26-18(25-16)27(5-2)6-3)23-14-11-9-8-10-13-21-15(19)20/h4-14H2,1-3H3,(H4,19,20,21)(H2,22,23,24,25,26) |
| InChIKey | KDMJQMQYUJKAJN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 130.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.56 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|