C25H36N2O6 — CID 10742639
ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitrospiro[7,8-dihydro-6H-naphthalene-5,1'-cyclohexane]-2-yl)propanoate (PubChem CID 10742639) has the molecular formula C25H36N2O6 and a molecular weight of 460.57 g/mol. Its IUPAC name is ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitrospiro[7,8-dihydro-6H-naphthalene-5,1'-cyclohexane]-2-yl)propanoate.
| Compound Name | ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitrospiro[7,8-dihydro-6H-naphthalene-5,1'-cyclohexane]-2-yl)propanoate |
|---|---|
| PubChem CID | 10742639 |
| Molecular Formula | C25H36N2O6 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitrospiro[7,8-dihydro-6H-naphthalene-5,1'-cyclohexane]-2-yl)propanoate |
| SMILES | CCOC(=O)C(Cc1cc2c(cc1[N+](=O)[O-])C1(CCCCC1)CCC2)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H36N2O6/c1-5-32-22(28)20(26-23(29)33-24(2,3)4)15-18-14-17-10-9-13-25(11-7-6-8-12-25)19(17)16-21(18)27(30)31/h14,16,20H,5-13,15H2,1-4H3,(H,26,29) |
| InChIKey | HJTDIRDTHHGEQA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|