C10H17N3O4 — CID 107426838
5-[3-(ethylamino)propylcarbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid (PubChem CID 107426838) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is 5-[3-(ethylamino)propylcarbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[3-(ethylamino)propylcarbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107426838 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 5-[3-(ethylamino)propylcarbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| SMILES | CCNCCCNC(=O)C1CC(C(=O)O)=NO1 |
| InChI | InChI=1S/C10H17N3O4/c1-2-11-4-3-5-12-9(14)8-6-7(10(15)16)13-17-8/h8,11H,2-6H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | WMTJLBYSNLWEGJ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|