C9H10N2O4 — CID 107427588
5-(but-3-yn-2-ylcarbamoyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid (PubChem CID 107427588) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is 5-(but-3-yn-2-ylcarbamoyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(but-3-yn-2-ylcarbamoyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107427588 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 5-(but-3-yn-2-ylcarbamoyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| SMILES | C#CC(C)NC(=O)C1CC(C(=O)O)=NO1 |
| InChI | InChI=1S/C9H10N2O4/c1-3-5(2)10-8(12)7-4-6(9(13)14)11-15-7/h1,5,7H,4H2,2H3,(H,10,12)(H,13,14) |
| InChIKey | OYAPLNFBTVWDOI-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|