C33H36O2 — CID 10742796
[(1'R,2'R,4'S)-1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2,3-diphenylpropanoate (PubChem CID 10742796) has the molecular formula C33H36O2 and a molecular weight of 464.65 g/mol. Its IUPAC name is [(1'R,2'R,4'S)-1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2,3-diphenylpropanoate.
| Compound Name | [(1'R,2'R,4'S)-1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2,3-diphenylpropanoate |
|---|---|
| PubChem CID | 10742796 |
| Molecular Formula | C33H36O2 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | [(1'R,2'R,4'S)-1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2,3-diphenylpropanoate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](OC(=O)C(Cc1ccccc1)c1ccccc1)C21Cc2ccccc2C1 |
| InChI | InChI=1S/C33H36O2/c1-31(2)28-18-19-32(31,3)30(33(28)21-25-16-10-11-17-26(25)22-33)35-29(34)27(24-14-8-5-9-15-24)20-23-12-6-4-7-13-23/h4-17,27-28,30H,18-22H2,1-3H3/t27?,28-,30-,32-/m0/s1 |
| InChIKey | NBIPDTLHSBHMLF-DFDGZESWSA-N |
| XLogP | 7.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |