C28H39NO3Si — CID 10742825
tert-butyl (4R)-4-[(E)-2-[tert-butyl(diphenyl)silyl]ethenyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 10742825) has the molecular formula C28H39NO3Si and a molecular weight of 465.71 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(E)-2-[tert-butyl(diphenyl)silyl]ethenyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(E)-2-[tert-butyl(diphenyl)silyl]ethenyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10742825 |
| Molecular Formula | C28H39NO3Si |
| Molecular Weight | 465.71 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | tert-butyl (4R)-4-[(E)-2-[tert-butyl(diphenyl)silyl]ethenyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](/C=C/[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)COC1(C)C |
| InChI | InChI=1S/C28H39NO3Si/c1-26(2,3)32-25(30)29-22(21-31-28(29,7)8)19-20-33(27(4,5)6,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-20,22H,21H2,1-8H3/b20-19+/t22-/m1/s1 |
| InChIKey | GULFFVUIUFPZOT-YVHXKWHWSA-N |
| XLogP | 5.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.71 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|