C19H38N2 — CID 107429031
[1-(4-ethyl-4-methylpiperidin-1-yl)-3-(2-methylpropyl)cyclohexyl]methanamine (PubChem CID 107429031) has the molecular formula C19H38N2 and a molecular weight of 294.53 g/mol. Its IUPAC name is [1-(4-ethyl-4-methylpiperidin-1-yl)-3-(2-methylpropyl)cyclohexyl]methanamine.
| Compound Name | [1-(4-ethyl-4-methylpiperidin-1-yl)-3-(2-methylpropyl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 107429031 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | [1-(4-ethyl-4-methylpiperidin-1-yl)-3-(2-methylpropyl)cyclohexyl]methanamine |
| SMILES | CCC1(C)CCN(C2(CN)CCCC(CC(C)C)C2)CC1 |
| InChI | InChI=1S/C19H38N2/c1-5-18(4)9-11-21(12-10-18)19(15-20)8-6-7-17(14-19)13-16(2)3/h16-17H,5-15,20H2,1-4H3 |
| InChIKey | ZAVYCHQSAVQTHQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |