C15H32N2O2S — CID 107429103
1-(aminomethyl)-N-methyl-3-(2-methylpropyl)-N-(2-methylsulfonylethyl)cyclohexan-1-amine (PubChem CID 107429103) has the molecular formula C15H32N2O2S and a molecular weight of 304.50 g/mol. Its IUPAC name is 1-(aminomethyl)-N-methyl-3-(2-methylpropyl)-N-(2-methylsulfonylethyl)cyclohexan-1-amine.
| Compound Name | 1-(aminomethyl)-N-methyl-3-(2-methylpropyl)-N-(2-methylsulfonylethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 107429103 |
| Molecular Formula | C15H32N2O2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-(aminomethyl)-N-methyl-3-(2-methylpropyl)-N-(2-methylsulfonylethyl)cyclohexan-1-amine |
| SMILES | CC(C)CC1CCCC(CN)(N(C)CCS(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H32N2O2S/c1-13(2)10-14-6-5-7-15(11-14,12-16)17(3)8-9-20(4,18)19/h13-14H,5-12,16H2,1-4H3 |
| InChIKey | NVTQJFDCILHHID-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |