C14H21BrO2 — CID 107429867
1-(3-bromofuran-2-yl)-3-(2-methylpropyl)cyclohexan-1-ol (PubChem CID 107429867) has the molecular formula C14H21BrO2 and a molecular weight of 301.22 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-3-(2-methylpropyl)cyclohexan-1-ol.
| Compound Name | 1-(3-bromofuran-2-yl)-3-(2-methylpropyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 107429867 |
| Molecular Formula | C14H21BrO2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-3-(2-methylpropyl)cyclohexan-1-ol |
| SMILES | CC(C)CC1CCCC(O)(c2occc2Br)C1 |
| InChI | InChI=1S/C14H21BrO2/c1-10(2)8-11-4-3-6-14(16,9-11)13-12(15)5-7-17-13/h5,7,10-11,16H,3-4,6,8-9H2,1-2H3 |
| InChIKey | GIWRXPPVQHAKEG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |