C13H17N — CID 107430275
N-[(2-ethenyl-4-methylphenyl)methyl]cyclopropanamine (PubChem CID 107430275) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is N-[(2-ethenyl-4-methylphenyl)methyl]cyclopropanamine.
| Compound Name | N-[(2-ethenyl-4-methylphenyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 107430275 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | N-[(2-ethenyl-4-methylphenyl)methyl]cyclopropanamine |
| SMILES | C=Cc1cc(C)ccc1CNC1CC1 |
| InChI | InChI=1S/C13H17N/c1-3-11-8-10(2)4-5-12(11)9-14-13-6-7-13/h3-5,8,13-14H,1,6-7,9H2,2H3 |
| InChIKey | QCVHGJIHNDTEMN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |