3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid

C12H14N4O2 — CID 107430910

IUPAC3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid
SMILESCCc1nn(-c2ccncn2)c(CC)c1C(=O)O
InChIInChI=1S/C12H14N4O2/c1-3-8-11(12(17)18)9(4-2)16(15-8)10-5-6-13-7-14-10/h5-7H,3-4H2,1-2H3,(H,17,18)
InChIKeyOMKQEYMXUMSJDU-UHFFFAOYSA-N
MW246.27 g/mol
LogP1.49
Rot. Bonds4

About 3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid

3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid (PubChem CID 107430910) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid.

Molecular Properties

Compound Name3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid
PubChem CID107430910
Molecular FormulaC12H14N4O2
Molecular Weight246.27 g/mol
Exact Mass246.11
IUPAC Name3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid
SMILESCCc1nn(-c2ccncn2)c(CC)c1C(=O)O
InChIInChI=1S/C12H14N4O2/c1-3-8-11(12(17)18)9(4-2)16(15-8)10-5-6-13-7-14-10/h5-7H,3-4H2,1-2H3,(H,17,18)
InChIKeyOMKQEYMXUMSJDU-UHFFFAOYSA-N
XLogP1.49
TPSA80.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.27
LogP ≤ 51.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid?
The IUPAC name of 3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid (CID 107430910) is 3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid.
What is the SMILES notation for 3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid?
The canonical SMILES for 3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid is CCc1nn(-c2ccncn2)c(CC)c1C(=O)O.
What is the InChIKey of 3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid?
The InChIKey is OMKQEYMXUMSJDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2/c1-3-8-11(12(17)18)9(4-2)16(15-8)10-5-6-13-7-14-10/h5-7H,3-4H2,1-2H3,(H,17,18).
What are the key properties of 3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid?
3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid has a molecular weight of 246.27 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-1-pyrimidin-4-ylpyrazole-4-carboxylic acid is sourced from PubChem (CID 107430910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).