C13H20N2O — CID 107430946
1-(1-cyclopropylethyl)-3,5-diethylpyrazole-4-carbaldehyde (PubChem CID 107430946) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 1-(1-cyclopropylethyl)-3,5-diethylpyrazole-4-carbaldehyde.
| Compound Name | 1-(1-cyclopropylethyl)-3,5-diethylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 107430946 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 1-(1-cyclopropylethyl)-3,5-diethylpyrazole-4-carbaldehyde |
| SMILES | CCc1nn(C(C)C2CC2)c(CC)c1C=O |
| InChI | InChI=1S/C13H20N2O/c1-4-12-11(8-16)13(5-2)15(14-12)9(3)10-6-7-10/h8-10H,4-7H2,1-3H3 |
| InChIKey | BOJMRHNZOJSUGK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|