C16H23BrN4 — CID 107431611
1-[1-(4-bromo-3-methylphenyl)-5-ethyltriazol-4-yl]-N-ethylpropan-1-amine (PubChem CID 107431611) has the molecular formula C16H23BrN4 and a molecular weight of 351.29 g/mol. Its IUPAC name is 1-[1-(4-bromo-3-methylphenyl)-5-ethyltriazol-4-yl]-N-ethylpropan-1-amine.
| Compound Name | 1-[1-(4-bromo-3-methylphenyl)-5-ethyltriazol-4-yl]-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 107431611 |
| Molecular Formula | C16H23BrN4 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 1-[1-(4-bromo-3-methylphenyl)-5-ethyltriazol-4-yl]-N-ethylpropan-1-amine |
| SMILES | CCNC(CC)c1nnn(-c2ccc(Br)c(C)c2)c1CC |
| InChI | InChI=1S/C16H23BrN4/c1-5-14(18-7-3)16-15(6-2)21(20-19-16)12-8-9-13(17)11(4)10-12/h8-10,14,18H,5-7H2,1-4H3 |
| InChIKey | YCMRUTWIRXMUKN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |