C13H15F3N4 — CID 107431682
1-[5-ethyl-1-(2,3,5-trifluorophenyl)triazol-4-yl]propan-1-amine (PubChem CID 107431682) has the molecular formula C13H15F3N4 and a molecular weight of 284.29 g/mol. Its IUPAC name is 1-[5-ethyl-1-(2,3,5-trifluorophenyl)triazol-4-yl]propan-1-amine.
| Compound Name | 1-[5-ethyl-1-(2,3,5-trifluorophenyl)triazol-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 107431682 |
| Molecular Formula | C13H15F3N4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1-[5-ethyl-1-(2,3,5-trifluorophenyl)triazol-4-yl]propan-1-amine |
| SMILES | CCc1c(C(N)CC)nnn1-c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C13H15F3N4/c1-3-9(17)13-10(4-2)20(19-18-13)11-6-7(14)5-8(15)12(11)16/h5-6,9H,3-4,17H2,1-2H3 |
| InChIKey | IIIDKNJRBLFEJP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|