C27H26FN3O4 — CID 10743174
phenyl N-[5-(2-fluorophenyl)-1-(3-methylbutyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamate (PubChem CID 10743174) has the molecular formula C27H26FN3O4 and a molecular weight of 475.52 g/mol. Its IUPAC name is phenyl N-[5-(2-fluorophenyl)-1-(3-methylbutyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamate.
| Compound Name | phenyl N-[5-(2-fluorophenyl)-1-(3-methylbutyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 10743174 |
| Molecular Formula | C27H26FN3O4 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | phenyl N-[5-(2-fluorophenyl)-1-(3-methylbutyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamate |
| SMILES | CC(C)CCN1C(=O)C(NC(=O)Oc2ccccc2)C(=O)N(c2ccccc2F)c2ccccc21 |
| InChI | InChI=1S/C27H26FN3O4/c1-18(2)16-17-30-22-14-8-9-15-23(22)31(21-13-7-6-12-20(21)28)26(33)24(25(30)32)29-27(34)35-19-10-4-3-5-11-19/h3-15,18,24H,16-17H2,1-2H3,(H,29,34) |
| InChIKey | DBJDNJWOWHBMES-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|