C14H18ClFN4 — CID 107431788
1-[1-(3-chloro-5-fluorophenyl)-5-ethyltriazol-4-yl]-N-methylpropan-1-amine (PubChem CID 107431788) has the molecular formula C14H18ClFN4 and a molecular weight of 296.78 g/mol. Its IUPAC name is 1-[1-(3-chloro-5-fluorophenyl)-5-ethyltriazol-4-yl]-N-methylpropan-1-amine.
| Compound Name | 1-[1-(3-chloro-5-fluorophenyl)-5-ethyltriazol-4-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 107431788 |
| Molecular Formula | C14H18ClFN4 |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 1-[1-(3-chloro-5-fluorophenyl)-5-ethyltriazol-4-yl]-N-methylpropan-1-amine |
| SMILES | CCc1c(C(CC)NC)nnn1-c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C14H18ClFN4/c1-4-12(17-3)14-13(5-2)20(19-18-14)11-7-9(15)6-10(16)8-11/h6-8,12,17H,4-5H2,1-3H3 |
| InChIKey | LODZZYWNCPNLMK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |